Organic acids and derivatives
Filtered Search Results
Methyl Dichloroacetate 99.0+%, TCI America™
CAS: 116-54-1 Molecular Formula: C3H4Cl2O2 Molecular Weight (g/mol): 142.963 MDL Number: MFCD00000843 InChI Key: HKMLRUAPIDAGIE-UHFFFAOYSA-N Synonym: methyl dichloroacetate,dichloroacetic acid methyl ester,acetic acid, dichloro-, methyl ester,ccris 7740,acetic acid, 2,2-dichloro-, methyl ester,methyldichloroethanoate,acmc-1brpm,dichloroacetic acid methyl,methyl2,2-dichloroacetate,wln: gygvo1 PubChem CID: 8315 IUPAC Name: methyl 2,2-dichloroacetate SMILES: COC(=O)C(Cl)Cl
| PubChem CID | 8315 |
|---|---|
| CAS | 116-54-1 |
| Molecular Weight (g/mol) | 142.963 |
| MDL Number | MFCD00000843 |
| SMILES | COC(=O)C(Cl)Cl |
| Synonym | methyl dichloroacetate,dichloroacetic acid methyl ester,acetic acid, dichloro-, methyl ester,ccris 7740,acetic acid, 2,2-dichloro-, methyl ester,methyldichloroethanoate,acmc-1brpm,dichloroacetic acid methyl,methyl2,2-dichloroacetate,wln: gygvo1 |
| IUPAC Name | methyl 2,2-dichloroacetate |
| InChI Key | HKMLRUAPIDAGIE-UHFFFAOYSA-N |
| Molecular Formula | C3H4Cl2O2 |
2-Ethoxyethyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
CAS: 2370-63-0 Molecular Formula: C8H14O3 Molecular Weight (g/mol): 158.20 MDL Number: MFCD00009249 InChI Key: SFPNZPQIIAJXGL-UHFFFAOYSA-N Synonym: 2-ethoxyethyl methacrylate,ethoxyethyl methacrylate,2-propenoic acid, 2-methyl-, 2-ethoxyethyl ester,2-ethoxy ethyl methacrylate,methacrylic acid, 2-ethoxyethyl ester,unii-5q6xr4mr8e,methacrylic acid 2-ethoxyethyl ester,5q6xr4mr8e,2-ethoxyethyl 2-methylacrylate,2-ethyloxy ethyl 2-methylprop-2-enoate PubChem CID: 71404 IUPAC Name: 2-ethoxyethyl 2-methylprop-2-enoate SMILES: CCOCCOC(=O)C(C)=C
| PubChem CID | 71404 |
|---|---|
| CAS | 2370-63-0 |
| Molecular Weight (g/mol) | 158.20 |
| MDL Number | MFCD00009249 |
| SMILES | CCOCCOC(=O)C(C)=C |
| Synonym | 2-ethoxyethyl methacrylate,ethoxyethyl methacrylate,2-propenoic acid, 2-methyl-, 2-ethoxyethyl ester,2-ethoxy ethyl methacrylate,methacrylic acid, 2-ethoxyethyl ester,unii-5q6xr4mr8e,methacrylic acid 2-ethoxyethyl ester,5q6xr4mr8e,2-ethoxyethyl 2-methylacrylate,2-ethyloxy ethyl 2-methylprop-2-enoate |
| IUPAC Name | 2-ethoxyethyl 2-methylprop-2-enoate |
| InChI Key | SFPNZPQIIAJXGL-UHFFFAOYSA-N |
| Molecular Formula | C8H14O3 |
Methyl 2,6-Dichlorophenylacetate 98.0+%, TCI America™
CAS: 54551-83-6 Molecular Formula: C9H8Cl2O2 Molecular Weight (g/mol): 219.061 MDL Number: MFCD00191640 InChI Key: FCWRUYPZZJPCCG-UHFFFAOYSA-N PubChem CID: 2734107 IUPAC Name: methyl 2-(2,6-dichlorophenyl)acetate SMILES: COC(=O)CC1=C(C=CC=C1Cl)Cl
| PubChem CID | 2734107 |
|---|---|
| CAS | 54551-83-6 |
| Molecular Weight (g/mol) | 219.061 |
| MDL Number | MFCD00191640 |
| SMILES | COC(=O)CC1=C(C=CC=C1Cl)Cl |
| IUPAC Name | methyl 2-(2,6-dichlorophenyl)acetate |
| InChI Key | FCWRUYPZZJPCCG-UHFFFAOYSA-N |
| Molecular Formula | C9H8Cl2O2 |
Ethyl 5H-Octafluorovalerate 98.0+%, TCI America™
CAS: 2795-50-8 Molecular Formula: C7H6F8O2 Molecular Weight (g/mol): 274.11 MDL Number: MFCD00153153 InChI Key: HXWMNJVBQLBDGW-UHFFFAOYSA-N Synonym: 5H-Octafluorovaleric Acid Ethyl Ester PubChem CID: 2737223 IUPAC Name: ethyl 2,2,3,3,4,4,5,5-octafluoropentanoate SMILES: CCOC(=O)C(C(C(C(F)F)(F)F)(F)F)(F)F
| PubChem CID | 2737223 |
|---|---|
| CAS | 2795-50-8 |
| Molecular Weight (g/mol) | 274.11 |
| MDL Number | MFCD00153153 |
| SMILES | CCOC(=O)C(C(C(C(F)F)(F)F)(F)F)(F)F |
| Synonym | 5H-Octafluorovaleric Acid Ethyl Ester |
| IUPAC Name | ethyl 2,2,3,3,4,4,5,5-octafluoropentanoate |
| InChI Key | HXWMNJVBQLBDGW-UHFFFAOYSA-N |
| Molecular Formula | C7H6F8O2 |
RPI 1 95.0+%, TCI America™
CAS: 269730-03-2 Molecular Formula: C17H15NO4 Molecular Weight (g/mol): 297.31 MDL Number: MFCD03852474 InChI Key: JGSMCYNBVCGIHC-UHFFFAOYSA-N Synonym: 1,3-Dihydro-5,6-dimethoxy-3-[(4-hydroxyphenyl)methylene]-1H-indol-2-one, 3-(4-Hydroxybenzylidene)-5,6-dimethoxyindolin-2-one PubChem CID: 1749978 IUPAC Name: 3-[(4-hydroxyphenyl)methylidene]-5,6-dimethoxy-2,3-dihydro-1H-indol-2-one SMILES: COC1=C(OC)C=C2C(NC(=O)C2=CC2=CC=C(O)C=C2)=C1
| PubChem CID | 1749978 |
|---|---|
| CAS | 269730-03-2 |
| Molecular Weight (g/mol) | 297.31 |
| MDL Number | MFCD03852474 |
| SMILES | COC1=C(OC)C=C2C(NC(=O)C2=CC2=CC=C(O)C=C2)=C1 |
| Synonym | 1,3-Dihydro-5,6-dimethoxy-3-[(4-hydroxyphenyl)methylene]-1H-indol-2-one, 3-(4-Hydroxybenzylidene)-5,6-dimethoxyindolin-2-one |
| IUPAC Name | 3-[(4-hydroxyphenyl)methylidene]-5,6-dimethoxy-2,3-dihydro-1H-indol-2-one |
| InChI Key | JGSMCYNBVCGIHC-UHFFFAOYSA-N |
| Molecular Formula | C17H15NO4 |
Isoamyl Lactate 98.0+%, TCI America™
CAS: 19329-89-6 Molecular Formula: C8H16O3 Molecular Weight (g/mol): 160.213 MDL Number: MFCD00046638 InChI Key: CRORGGSWAKIXSA-UHFFFAOYSA-N Synonym: Lactic Acid Isoamyl Ester, Isopentyl Lactate PubChem CID: 86851 ChEBI: CHEBI:87534 IUPAC Name: 3-methylbutyl 2-hydroxypropanoate SMILES: CC(C)CCOC(=O)C(C)O
| PubChem CID | 86851 |
|---|---|
| CAS | 19329-89-6 |
| Molecular Weight (g/mol) | 160.213 |
| ChEBI | CHEBI:87534 |
| MDL Number | MFCD00046638 |
| SMILES | CC(C)CCOC(=O)C(C)O |
| Synonym | Lactic Acid Isoamyl Ester, Isopentyl Lactate |
| IUPAC Name | 3-methylbutyl 2-hydroxypropanoate |
| InChI Key | CRORGGSWAKIXSA-UHFFFAOYSA-N |
| Molecular Formula | C8H16O3 |
Ethyl 3-(Trifluoromethyl)pyrazole-4-carboxylate 98.0+%, TCI America™
CAS: 155377-19-8 Molecular Formula: C7H7F3N2O2 Molecular Weight (g/mol): 208.14 MDL Number: MFCD00052083 InChI Key: VYXIHSAEOXPAEY-UHFFFAOYSA-N Synonym: ethyl 3-trifluoromethyl pyrazole-4-carboxylate,ethyl 3-trifluoromethyl-1h-pyrazole-4-carboxylate,ethyl 5-trifluoromethyl-1h-pyrazole-4-carboxylate,3-trifluoromethyl-1h-pyrazole-4-carboxylic acid ethyl ester,3-trifluoromethyl pyrazole-4-carboxylic acid ethyl ester,ethyl 3-trifluoromethyl-2h-pyrazole-4-carboxylate,5-trifluoromethyl-1h-pyrazole-4-carboxylic acid ethyl ester,1h-pyrazole-4-carboxylic acid, 3-trifluoromethyl-, ethyl ester PubChem CID: 596095 IUPAC Name: ethyl 5-(trifluoromethyl)-1H-pyrazole-4-carboxylate SMILES: CCOC(=O)C1=C(NN=C1)C(F)(F)F
| PubChem CID | 596095 |
|---|---|
| CAS | 155377-19-8 |
| Molecular Weight (g/mol) | 208.14 |
| MDL Number | MFCD00052083 |
| SMILES | CCOC(=O)C1=C(NN=C1)C(F)(F)F |
| Synonym | ethyl 3-trifluoromethyl pyrazole-4-carboxylate,ethyl 3-trifluoromethyl-1h-pyrazole-4-carboxylate,ethyl 5-trifluoromethyl-1h-pyrazole-4-carboxylate,3-trifluoromethyl-1h-pyrazole-4-carboxylic acid ethyl ester,3-trifluoromethyl pyrazole-4-carboxylic acid ethyl ester,ethyl 3-trifluoromethyl-2h-pyrazole-4-carboxylate,5-trifluoromethyl-1h-pyrazole-4-carboxylic acid ethyl ester,1h-pyrazole-4-carboxylic acid, 3-trifluoromethyl-, ethyl ester |
| IUPAC Name | ethyl 5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| InChI Key | VYXIHSAEOXPAEY-UHFFFAOYSA-N |
| Molecular Formula | C7H7F3N2O2 |
Dimethyl Homoterephthalate 98.0+%, TCI America™
CAS: 52787-14-1 Molecular Formula: C11H12O4 Molecular Weight (g/mol): 208.213 MDL Number: MFCD07779210 InChI Key: QAQYBHOZQQRJBA-UHFFFAOYSA-N Synonym: Homoterephthalic Acid Dimethyl Ester, Methyl 4-Methoxycarbonylphenylacetate, 4-Methoxycarbonylphenylacetic Acid Methyl Ester, Methyl 4-(2-Methoxy-2-oxoethyl)benzoate, 4-(2-Methoxy-2-oxoethyl)benzoic Acid Methyl Ester PubChem CID: 10536335 IUPAC Name: methyl 4-(2-methoxy-2-oxoethyl)benzoate SMILES: COC(=O)CC1=CC=C(C=C1)C(=O)OC
| PubChem CID | 10536335 |
|---|---|
| CAS | 52787-14-1 |
| Molecular Weight (g/mol) | 208.213 |
| MDL Number | MFCD07779210 |
| SMILES | COC(=O)CC1=CC=C(C=C1)C(=O)OC |
| Synonym | Homoterephthalic Acid Dimethyl Ester, Methyl 4-Methoxycarbonylphenylacetate, 4-Methoxycarbonylphenylacetic Acid Methyl Ester, Methyl 4-(2-Methoxy-2-oxoethyl)benzoate, 4-(2-Methoxy-2-oxoethyl)benzoic Acid Methyl Ester |
| IUPAC Name | methyl 4-(2-methoxy-2-oxoethyl)benzoate |
| InChI Key | QAQYBHOZQQRJBA-UHFFFAOYSA-N |
| Molecular Formula | C11H12O4 |
4-tert-Butylcyclohexyl Acetate (cis- and trans- mixture) 96.0+%, TCI America™
CAS: 32210-23-4 Molecular Formula: C12H22O2 Molecular Weight (g/mol): 198.31 MDL Number: MFCD00019354 InChI Key: MBZRJSQZCBXRGK-UHFFFAOYSA-N Synonym: Acetic Acid 4-tert-Butylcyclohexyl Ester PubChem CID: 36081 IUPAC Name: 4-tert-butylcyclohexyl acetate SMILES: CC(=O)OC1CCC(CC1)C(C)(C)C
| PubChem CID | 36081 |
|---|---|
| CAS | 32210-23-4 |
| Molecular Weight (g/mol) | 198.31 |
| MDL Number | MFCD00019354 |
| SMILES | CC(=O)OC1CCC(CC1)C(C)(C)C |
| Synonym | Acetic Acid 4-tert-Butylcyclohexyl Ester |
| IUPAC Name | 4-tert-butylcyclohexyl acetate |
| InChI Key | MBZRJSQZCBXRGK-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2 |
4-(2-Bromoethyl)benzenesulfonic Acid 97.0+%, TCI America™
CAS: 54322-31-5 Molecular Formula: C8H9BrO3S Molecular Weight (g/mol): 265.121 MDL Number: MFCD01861279 InChI Key: XRPCDXSRXPQUKT-UHFFFAOYSA-N PubChem CID: 103071 IUPAC Name: 4-(2-bromoethyl)benzenesulfonic acid SMILES: C1=CC(=CC=C1CCBr)S(=O)(=O)O
| PubChem CID | 103071 |
|---|---|
| CAS | 54322-31-5 |
| Molecular Weight (g/mol) | 265.121 |
| MDL Number | MFCD01861279 |
| SMILES | C1=CC(=CC=C1CCBr)S(=O)(=O)O |
| IUPAC Name | 4-(2-bromoethyl)benzenesulfonic acid |
| InChI Key | XRPCDXSRXPQUKT-UHFFFAOYSA-N |
| Molecular Formula | C8H9BrO3S |
4-Cyclohexanebutyric Acid 98.0+%, TCI America™
CAS: 4441-63-8 Molecular Formula: C10H18O2 Molecular Weight (g/mol): 170.252 MDL Number: MFCD00001529 InChI Key: UVZMNGNFERVGRC-UHFFFAOYSA-N Synonym: 4-cyclohexylbutyric acid,cyclohexanebutyric acid,cyclohexanebutanoic acid,4-cyclohexanebutyric acid,cyclohexanebutyricacid,pubchem15521,acmc-20aj2k,cyclohexane-butyric acid,4-cyclohexanebutyricacid,4-cyclohexyl butyric acid PubChem CID: 75200 IUPAC Name: 4-cyclohexylbutanoic acid SMILES: C1CCC(CC1)CCCC(=O)O
| PubChem CID | 75200 |
|---|---|
| CAS | 4441-63-8 |
| Molecular Weight (g/mol) | 170.252 |
| MDL Number | MFCD00001529 |
| SMILES | C1CCC(CC1)CCCC(=O)O |
| Synonym | 4-cyclohexylbutyric acid,cyclohexanebutyric acid,cyclohexanebutanoic acid,4-cyclohexanebutyric acid,cyclohexanebutyricacid,pubchem15521,acmc-20aj2k,cyclohexane-butyric acid,4-cyclohexanebutyricacid,4-cyclohexyl butyric acid |
| IUPAC Name | 4-cyclohexylbutanoic acid |
| InChI Key | UVZMNGNFERVGRC-UHFFFAOYSA-N |
| Molecular Formula | C10H18O2 |
Methyl 1,2,3,4-Tetra-O-acetyl-beta-D-glucuronate 96.0+%, TCI America™
CAS: 7355-18-2 Molecular Formula: C15H20O11 Molecular Weight (g/mol): 376.314 MDL Number: MFCD00069834 InChI Key: DPOQCELSZBSZGX-XOBFJNJYSA-N Synonym: 2s,3r,4s,5s,6s-6-methoxycarbonyl tetrahydro-2h-pyran-2,3,4,5-tetrayl tetraacetate,methyl o-tetraacetyl-beta-d-glucopyranuronate,methyl 1,2,3,4-tetra-o-acetyl-beta-d-glucuronate,methyl 1,2,3,4-tetra-o-acetyl-beta-d-glucopyranuronate,methyl 2s,3s,4s,5r,6s-3,4,5,6-tetrakis acetyloxy oxane-2-carboxylate,1,2,3,4-tetra-o-acetyl-beta-d-glucopyranuronic acid methyl ester,methyl 1,2,3,4-tetra-o-acetyl-,a-d-glucopyranuronate,beta-d-glucopyranuronic acid, methyl ester, tetraacetate,methyl 1,2,3,4-tetra-o-acetyl-d-glucuronate,1,2,3,4-tetra-o-acetyl-d-glucuronide methyl ester PubChem CID: 95087 IUPAC Name: methyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate SMILES: CC(=O)OC1C(C(OC(C1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C
| PubChem CID | 95087 |
|---|---|
| CAS | 7355-18-2 |
| Molecular Weight (g/mol) | 376.314 |
| MDL Number | MFCD00069834 |
| SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C |
| Synonym | 2s,3r,4s,5s,6s-6-methoxycarbonyl tetrahydro-2h-pyran-2,3,4,5-tetrayl tetraacetate,methyl o-tetraacetyl-beta-d-glucopyranuronate,methyl 1,2,3,4-tetra-o-acetyl-beta-d-glucuronate,methyl 1,2,3,4-tetra-o-acetyl-beta-d-glucopyranuronate,methyl 2s,3s,4s,5r,6s-3,4,5,6-tetrakis acetyloxy oxane-2-carboxylate,1,2,3,4-tetra-o-acetyl-beta-d-glucopyranuronic acid methyl ester,methyl 1,2,3,4-tetra-o-acetyl-,a-d-glucopyranuronate,beta-d-glucopyranuronic acid, methyl ester, tetraacetate,methyl 1,2,3,4-tetra-o-acetyl-d-glucuronate,1,2,3,4-tetra-o-acetyl-d-glucuronide methyl ester |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| InChI Key | DPOQCELSZBSZGX-XOBFJNJYSA-N |
| Molecular Formula | C15H20O11 |
Methyl Benzimidate Hydrochloride 98.0+%, TCI America™
CAS: 5873-90-5 Molecular Formula: C8H10ClNO Molecular Weight (g/mol): 171.624 MDL Number: MFCD00012575 InChI Key: HDJNHVNQRJMWSH-UHFFFAOYSA-N Synonym: methyl benzimidate hydrochloride,methyl benzimidate hcl,methyl benzenecarboximidoate hydrochloride,benzimidic acid methyl ester hydrochloride,methyl benzenecarboximidate hydrochloride,benzenecarboximidic acid methyl ester hydrochloride,benzinidic acid methyl ester hydrochloride,benzenecarboximidic acid, methyl ester, hydrochloride,methoxyphenylmethanimine, chloride,acmc-1axhh PubChem CID: 5743287 IUPAC Name: methyl benzenecarboximidate;hydrochloride SMILES: COC(=N)C1=CC=CC=C1.Cl
| PubChem CID | 5743287 |
|---|---|
| CAS | 5873-90-5 |
| Molecular Weight (g/mol) | 171.624 |
| MDL Number | MFCD00012575 |
| SMILES | COC(=N)C1=CC=CC=C1.Cl |
| Synonym | methyl benzimidate hydrochloride,methyl benzimidate hcl,methyl benzenecarboximidoate hydrochloride,benzimidic acid methyl ester hydrochloride,methyl benzenecarboximidate hydrochloride,benzenecarboximidic acid methyl ester hydrochloride,benzinidic acid methyl ester hydrochloride,benzenecarboximidic acid, methyl ester, hydrochloride,methoxyphenylmethanimine, chloride,acmc-1axhh |
| IUPAC Name | methyl benzenecarboximidate;hydrochloride |
| InChI Key | HDJNHVNQRJMWSH-UHFFFAOYSA-N |
| Molecular Formula | C8H10ClNO |
(S)-(+)-1,1'-Binaphthyl-2,2'-diyl Bis(trifluoromethanesulfonate) 93.0+%, TCI America™
CAS: 128544-05-8 Molecular Formula: C22H12F6O6S2 Molecular Weight (g/mol): 550.442 MDL Number: MFCD00274615 InChI Key: OYJLCOSEYYZULE-UHFFFAOYSA-N Synonym: r-1,1'-binaphthalene-2,2'-diyl bis trifluoromethanesulfonate,s-1,1'-binaphthalene-2,2'-diyl bis trifluoromethanesulfonate,r---1,1'-bi-2-naphthol bis trifluoromethanesulfonate,r---1,1'-binaphthol-2,2'-bis trifluoromethanesulfonate,s-+-1,1'-bi-2-naphthol bis trifluoromethanesulfonate,r-1,1'-binaphthyl-2,2'-diyl bis trifluoromethane sulphonate,s-+-1,1'-binaphthol-2,2'-bis trifluoromethanesulfonate,1,1'-bi-2-naphthol bis trifluoromethanesulfonate,s-1,1'-bi 2-naphthol bis trifluoromethanesulfonate,r---binol-tf2 PubChem CID: 389883 IUPAC Name: [1-[2-(trifluoromethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate SMILES: C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F
| PubChem CID | 389883 |
|---|---|
| CAS | 128544-05-8 |
| Molecular Weight (g/mol) | 550.442 |
| MDL Number | MFCD00274615 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| Synonym | r-1,1'-binaphthalene-2,2'-diyl bis trifluoromethanesulfonate,s-1,1'-binaphthalene-2,2'-diyl bis trifluoromethanesulfonate,r---1,1'-bi-2-naphthol bis trifluoromethanesulfonate,r---1,1'-binaphthol-2,2'-bis trifluoromethanesulfonate,s-+-1,1'-bi-2-naphthol bis trifluoromethanesulfonate,r-1,1'-binaphthyl-2,2'-diyl bis trifluoromethane sulphonate,s-+-1,1'-binaphthol-2,2'-bis trifluoromethanesulfonate,1,1'-bi-2-naphthol bis trifluoromethanesulfonate,s-1,1'-bi 2-naphthol bis trifluoromethanesulfonate,r---binol-tf2 |
| IUPAC Name | [1-[2-(trifluoromethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
| InChI Key | OYJLCOSEYYZULE-UHFFFAOYSA-N |
| Molecular Formula | C22H12F6O6S2 |
1,1,1,3,3,3-Hexafluoroisopropyl Acrylate (stabilized with TBC) 98.0+%, TCI America™
CAS: 2160-89-6 Molecular Formula: C6H4F6O2 Molecular Weight (g/mol): 222.09 MDL Number: MFCD00040104 InChI Key: MNSWITGNWZSAMC-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate PubChem CID: 75096 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-enoate SMILES: FC(F)(F)C(OC(=O)C=C)C(F)(F)F
| PubChem CID | 75096 |
|---|---|
| CAS | 2160-89-6 |
| Molecular Weight (g/mol) | 222.09 |
| MDL Number | MFCD00040104 |
| SMILES | FC(F)(F)C(OC(=O)C=C)C(F)(F)F |
| Synonym | 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl prop-2-enoate |
| InChI Key | MNSWITGNWZSAMC-UHFFFAOYSA-N |
| Molecular Formula | C6H4F6O2 |